ChemNet > CAS > 322-46-3 Pyrido[2,3-b]pyrazine
322-46-3 Pyrido[2,3-b]pyrazine
| Nama produk |
Pyrido[2,3-b]pyrazine |
| Nama bahasa Inggris |
Pyrido[2,3-b]pyrazine; 1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
| MF |
C7H5N3 |
| Berat Molekul |
131.1347 |
| InChI |
InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
| CAS NO |
322-46-3 |
| EINECS |
206-294-9 |
| Struktur Molekul |
![322-46-3 Pyrido[2,3-b]pyrazine](https://images-a.chemnet.com/suppliers/chembase/309/3093.gif)
|
| Kepadatan |
1.27g/cm3 |
| Titik lebur |
139-143℃ |
| Titik didih |
253.9°C at 760 mmHg |
| Indeks bias |
1.665 |
| Titik nyala |
115.9°C |
| Tekanan uap |
0.0284mmHg at 25°C |
| Simbol bahaya |
 Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
